C21H20FN5O2S — CID 123826070
N-[3-[(4aS,5S,7aR)-2-amino-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 123826070) has the molecular formula C21H20FN5O2S and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[3-[(4aS,5S,7aR)-2-amino-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,5S,7aR)-2-amino-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 123826070 |
| Molecular Formula | C21H20FN5O2S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[3-[(4aS,5S,7aR)-2-amino-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | CC[C@@H]1OC[C@@]2(c3cc(NC(=O)c4ccc(C#N)cn4)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C21H20FN5O2S/c1-2-18-15-10-30-20(24)27-21(15,11-29-18)14-7-13(4-5-16(14)22)26-19(28)17-6-3-12(8-23)9-25-17/h3-7,9,15,18H,2,10-11H2,1H3,(H2,24,27)(H,26,28)/t15-,18+,21+/m1/s1 |
| InChIKey | HBFQYHDPXFHITA-YWMUFLPLSA-N |
| XLogP | 3.03 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |