C23H18F2N8OS — CID 86762787
N-[3-[(4aR,7aS)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 86762787) has the molecular formula C23H18F2N8OS and a molecular weight of 492.52 g/mol. Its IUPAC name is N-[3-[(4aR,7aS)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR,7aS)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 86762787 |
| Molecular Formula | C23H18F2N8OS |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-[3-[(4aR,7aS)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(F)c([C@]34CN(c5ncc(F)cn5)C[C@H]3CSC(N)=N4)c2)nc1 |
| InChI | InChI=1S/C23H18F2N8OS/c24-15-8-29-22(30-9-15)33-10-14-11-35-21(27)32-23(14,12-33)17-5-16(2-3-18(17)25)31-20(34)19-4-1-13(6-26)7-28-19/h1-5,7-9,14H,10-12H2,(H2,27,32)(H,31,34)/t14-,23-/m0/s1 |
| InChIKey | VWFFFAAZOKVHQK-PSLXWICFSA-N |
| XLogP | 2.67 |
| TPSA | 133.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |