C20H17F2N5O2S — CID 67217181
N-[3-[(4aS)-2-amino-5-fluoro-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 67217181) has the molecular formula C20H17F2N5O2S and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[3-[(4aS)-2-amino-5-fluoro-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS)-2-amino-5-fluoro-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 67217181 |
| Molecular Formula | C20H17F2N5O2S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-[(4aS)-2-amino-5-fluoro-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(F)c(C34COCC(F)[C@H]3CSC(N)=N4)c2)nc1 |
| InChI | InChI=1S/C20H17F2N5O2S/c21-15-3-2-12(26-18(28)17-4-1-11(6-23)7-25-17)5-13(15)20-10-29-8-16(22)14(20)9-30-19(24)27-20/h1-5,7,14,16H,8-10H2,(H2,24,27)(H,26,28)/t14-,16?,20?/m1/s1 |
| InChIKey | TTXJCEXKAMEQCK-PCVOSPCESA-N |
| XLogP | 2.59 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |