C22H18ClF4N5O2 — CID 162607925
N-[3-[(3S,4aS,5S,7aS)-2-amino-3-ethynyl-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-chloropyrimidine-2-carboxamide (PubChem CID 162607925) has the molecular formula C22H18ClF4N5O2 and a molecular weight of 495.86 g/mol. Its IUPAC name is N-[3-[(3S,4aS,5S,7aS)-2-amino-3-ethynyl-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-chloropyrimidine-2-carboxamide.
| Compound Name | N-[3-[(3S,4aS,5S,7aS)-2-amino-3-ethynyl-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-chloropyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 162607925 |
| Molecular Formula | C22H18ClF4N5O2 |
| Molecular Weight | 495.86 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[3-[(3S,4aS,5S,7aS)-2-amino-3-ethynyl-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-chloropyrimidine-2-carboxamide |
| SMILES | C#C[C@]1(C)C[C@@H]2[C@@H](C(F)(F)F)OC[C@]2(c2cc(NC(=O)c3ncc(Cl)cn3)ccc2F)N=C1N |
| InChI | InChI=1S/C22H18ClF4N5O2/c1-3-20(2)7-14-16(22(25,26)27)34-10-21(14,32-19(20)28)13-6-12(4-5-15(13)24)31-18(33)17-29-8-11(23)9-30-17/h1,4-6,8-9,14,16H,7,10H2,2H3,(H2,28,32)(H,31,33)/t14-,16+,20-,21-/m1/s1 |
| InChIKey | FGCLAMUVNNIOSB-MGTBRSBRSA-N |
| XLogP | 3.69 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|