C21H19F4N5O3 — CID 163679181
N-[3-[(5S)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-3-cyano-1-methyl-2H-pyridine-6-carboxamide (PubChem CID 163679181) has the molecular formula C21H19F4N5O3 and a molecular weight of 465.41 g/mol. Its IUPAC name is N-[3-[(5S)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-3-cyano-1-methyl-2H-pyridine-6-carboxamide.
| Compound Name | N-[3-[(5S)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-3-cyano-1-methyl-2H-pyridine-6-carboxamide |
|---|---|
| PubChem CID | 163679181 |
| Molecular Formula | C21H19F4N5O3 |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[3-[(5S)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-3-cyano-1-methyl-2H-pyridine-6-carboxamide |
| SMILES | CN1CC(C#N)=CC=C1C(=O)Nc1ccc(F)c(C23CO[C@H](C(F)(F)F)C2COC(N)=N3)c1 |
| InChI | InChI=1S/C21H19F4N5O3/c1-30-8-11(7-26)2-5-16(30)18(31)28-12-3-4-15(22)13(6-12)20-10-33-17(21(23,24)25)14(20)9-32-19(27)29-20/h2-6,14,17H,8-10H2,1H3,(H2,27,29)(H,28,31)/t14?,17-,20?/m0/s1 |
| InChIKey | JJIYDARJNYWUOH-WSGJVKOYSA-N |
| XLogP | 2.16 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |