C28H22F6N4O4 — CID 138534050
N-[3-[(4aR,7aS)-2-benzamido-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 138534050) has the molecular formula C28H22F6N4O4 and a molecular weight of 592.50 g/mol. Its IUPAC name is N-[3-[(4aR,7aS)-2-benzamido-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR,7aS)-2-benzamido-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138534050 |
| Molecular Formula | C28H22F6N4O4 |
| Molecular Weight | 592.50 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | N-[3-[(4aR,7aS)-2-benzamido-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CC(F)(F)C1OC[C@]2(c3cc(NC(=O)c4ccc(C(F)(F)F)cn4)ccc3F)N=C(NC(=O)c3ccccc3)OC[C@H]12 |
| InChI | InChI=1S/C28H22F6N4O4/c1-26(30,31)22-19-13-41-25(37-23(39)15-5-3-2-4-6-15)38-27(19,14-42-22)18-11-17(8-9-20(18)29)36-24(40)21-10-7-16(12-35-21)28(32,33)34/h2-12,19,22H,13-14H2,1H3,(H,36,40)(H,37,38,39)/t19-,22?,27-/m1/s1 |
| InChIKey | RLPJSXHINYFACE-BXJNBTSESA-N |
| XLogP | 5.17 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |