C20H15F7N4O3 — CID 87184898
N-[3-[(4aR,5S,7aS)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 87184898) has the molecular formula C20H15F7N4O3 and a molecular weight of 492.35 g/mol. Its IUPAC name is N-[3-[(4aR,5S,7aS)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR,5S,7aS)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87184898 |
| Molecular Formula | C20H15F7N4O3 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-[3-[(4aR,5S,7aS)-2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-7a-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | NC1=NC[C@@H]2[C@@H](C(F)(F)F)OC[C@]2(c2cc(NC(=O)c3ccc(C(F)(F)F)cn3)ccc2F)O1 |
| InChI | InChI=1S/C20H15F7N4O3/c21-13-3-2-10(31-16(32)14-4-1-9(6-29-14)19(22,23)24)5-11(13)18-8-33-15(20(25,26)27)12(18)7-30-17(28)34-18/h1-6,12,15H,7-8H2,(H2,28,30)(H,31,32)/t12-,15+,18-/m1/s1 |
| InChIKey | BOGILBKQLWXULW-HNJNHCNJSA-N |
| XLogP | 3.61 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |