C17H19F3N4O — CID 146414753
(4aS,7aS)-2-amino-7a-(5-amino-2-fluorophenyl)-5-(1,1-difluoroethyl)-3-methyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile (PubChem CID 146414753) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is (4aS,7aS)-2-amino-7a-(5-amino-2-fluorophenyl)-5-(1,1-difluoroethyl)-3-methyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile.
| Compound Name | (4aS,7aS)-2-amino-7a-(5-amino-2-fluorophenyl)-5-(1,1-difluoroethyl)-3-methyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146414753 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (4aS,7aS)-2-amino-7a-(5-amino-2-fluorophenyl)-5-(1,1-difluoroethyl)-3-methyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridine-3-carbonitrile |
| SMILES | CC1(C#N)C[C@@H]2C(C(C)(F)F)OC[C@]2(c2cc(N)ccc2F)N=C1N |
| InChI | InChI=1S/C17H19F3N4O/c1-15(7-21)6-11-13(16(2,19)20)25-8-17(11,24-14(15)23)10-5-9(22)3-4-12(10)18/h3-5,11,13H,6,8,22H2,1-2H3,(H2,23,24)/t11-,13?,15?,17-/m1/s1 |
| InChIKey | AQLYKXVQUOBCOW-WWJKNXHQSA-N |
| XLogP | 2.56 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|