C20H24F4N2O4 — CID 159621818
tert-butyl 2-[(4S,4aS,5R)-7a-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate (PubChem CID 159621818) has the molecular formula C20H24F4N2O4 and a molecular weight of 432.41 g/mol. Its IUPAC name is tert-butyl 2-[(4S,4aS,5R)-7a-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[(4S,4aS,5R)-7a-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate |
|---|---|
| PubChem CID | 159621818 |
| Molecular Formula | C20H24F4N2O4 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | tert-butyl 2-[(4S,4aS,5R)-7a-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate |
| SMILES | C[C@H]1OCC2(c3cc(N)ccc3F)N=C(CC(=O)OC(C)(C)C)O[C@H](C(F)(F)F)[C@H]12 |
| InChI | InChI=1S/C20H24F4N2O4/c1-10-16-17(20(22,23)24)29-14(8-15(27)30-18(2,3)4)26-19(16,9-28-10)12-7-11(25)5-6-13(12)21/h5-7,10,16-17H,8-9,25H2,1-4H3/t10-,16+,17+,19?/m1/s1 |
| InChIKey | MNZFUDADHOBMFK-YVNIFCKLSA-N |
| XLogP | 3.73 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|