C18H17F2N4O2S+ — CID 117072345
N-[3-[(4aS,7aS)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-1-ium-7a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 117072345) has the molecular formula C18H17F2N4O2S+ and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[3-[(4aS,7aS)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-1-ium-7a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,7aS)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-1-ium-7a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 117072345 |
| Molecular Formula | C18H17F2N4O2S+ |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[3-[(4aS,7aS)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-1-ium-7a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | NC1=[NH+][C@@]2(c3cc(NC(=O)c4ccc(F)cn4)ccc3F)COC[C@H]2CS1 |
| InChI | InChI=1S/C18H16F2N4O2S/c19-11-1-4-15(22-6-11)16(25)23-12-2-3-14(20)13(5-12)18-9-26-7-10(18)8-27-17(21)24-18/h1-6,10H,7-9H2,(H2,21,24)(H,23,25)/p+1/t10-,18-/m0/s1 |
| InChIKey | NIDRNVHMMDAAIK-YPMLDQLKSA-O |
| XLogP | 0.60 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |