C21H21FN4O4S — CID 86715899
3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-N-(4-cyano-2-hydroxyphenyl)-4-fluorobenzamide (PubChem CID 86715899) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-N-(4-cyano-2-hydroxyphenyl)-4-fluorobenzamide.
| Compound Name | 3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-N-(4-cyano-2-hydroxyphenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 86715899 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-N-(4-cyano-2-hydroxyphenyl)-4-fluorobenzamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(C(=O)Nc3ccc(C#N)cc3O)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C21H21FN4O4S/c1-20(2)19(24)26-21(3,11-31(20,29)30)14-9-13(5-6-15(14)22)18(28)25-16-7-4-12(10-23)8-17(16)27/h4-9,27H,11H2,1-3H3,(H2,24,26)(H,25,28)/t21-/m0/s1 |
| InChIKey | AFLCZLQKLWUSJR-NRFANRHFSA-N |
| XLogP | 2.43 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|