C22H26N4O5S — CID 123485390
N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-5-methoxy-3-methylpyridine-2-carboxamide (PubChem CID 123485390) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-5-methoxy-3-methylpyridine-2-carboxamide.
| Compound Name | N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-5-methoxy-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123485390 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-5-methoxy-3-methylpyridine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc3c(c2)C2(CCO3)CS(=O)(=O)C(C)(C)C(N)=N2)c(C)c1 |
| InChI | InChI=1S/C22H26N4O5S/c1-13-9-15(30-4)11-24-18(13)19(27)25-14-5-6-17-16(10-14)22(7-8-31-17)12-32(28,29)21(2,3)20(23)26-22/h5-6,9-11H,7-8,12H2,1-4H3,(H2,23,26)(H,25,27) |
| InChIKey | KUYFHHRJFRJYSE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |