C17H23N3O5S — CID 123581683
N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-2-methoxyacetamide (PubChem CID 123581683) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-2-methoxyacetamide.
| Compound Name | N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 123581683 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc2c(c1)C1(CCO2)CS(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C17H23N3O5S/c1-16(2)15(18)20-17(10-26(16,22)23)6-7-25-13-5-4-11(8-12(13)17)19-14(21)9-24-3/h4-5,8H,6-7,9-10H2,1-3H3,(H2,18,20)(H,19,21) |
| InChIKey | JTFCKWSQNBYCHP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |