C23H25F5N4O2S — CID 135303660
(4S,6R)-4-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]ethenyl]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine (PubChem CID 135303660) has the molecular formula C23H25F5N4O2S and a molecular weight of 516.54 g/mol. Its IUPAC name is (4S,6R)-4-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]ethenyl]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,6R)-4-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]ethenyl]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 135303660 |
| Molecular Formula | C23H25F5N4O2S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (4S,6R)-4-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]ethenyl]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine |
| SMILES | COC[C@@]1(C)C[C@@](C)(c2cc(/C=C(\F)c3cnc(OC(C)C(F)(F)F)cn3)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C23H25F5N4O2S/c1-13(23(26,27)28)34-19-10-30-18(9-31-19)17(25)8-14-5-6-16(24)15(7-14)22(3)11-21(2,12-33-4)35-20(29)32-22/h5-10,13H,11-12H2,1-4H3,(H2,29,32)/b17-8-/t13?,21-,22+/m1/s1 |
| InChIKey | IHTKTHGIHMCPOT-MQMOGKDDSA-N |
| XLogP | 5.48 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |