C25H22FN5O2S — CID 90401987
N-[3-[(4aR)-2-benzamido-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 90401987) has the molecular formula C25H22FN5O2S and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[3-[(4aR)-2-benzamido-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR)-2-benzamido-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 90401987 |
| Molecular Formula | C25H22FN5O2S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[3-[(4aR)-2-benzamido-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | O=C(NC1=NC2(c3cccc(NC(=O)c4ccc(F)cn4)c3)CNC[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C25H22FN5O2S/c26-19-9-10-21(28-13-19)23(33)29-20-8-4-7-17(11-20)25-15-27-12-18(25)14-34-24(31-25)30-22(32)16-5-2-1-3-6-16/h1-11,13,18,27H,12,14-15H2,(H,29,33)(H,30,31,32)/t18-,25?/m0/s1 |
| InChIKey | ZUNWHRHNQOUEKY-CPFIQGLUSA-N |
| XLogP | 3.42 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |