C18H17FN4OS — CID 90121147
N-[(4aR,7aR)-7a-(5-fluoro-2-pyridinyl)-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 90121147) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[(4aR,7aR)-7a-(5-fluoro-2-pyridinyl)-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aR)-7a-(5-fluoro-2-pyridinyl)-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 90121147 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[(4aR,7aR)-7a-(5-fluoro-2-pyridinyl)-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | O=C(NC1=N[C@@]2(c3ccc(F)cn3)CNC[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C18H17FN4OS/c19-14-6-7-15(21-9-14)18-11-20-8-13(18)10-25-17(23-18)22-16(24)12-4-2-1-3-5-12/h1-7,9,13,20H,8,10-11H2,(H,22,23,24)/t13-,18-/m0/s1 |
| InChIKey | RQJKVMZLACGTKR-UGSOOPFHSA-N |
| XLogP | 2.17 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |