C23H25FN4O3S — CID 118306246
(4aR,7aR)-2-benzamido-4-tert-butyl-7a-(5-fluoro-2-pyridinyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid (PubChem CID 118306246) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is (4aR,7aR)-2-benzamido-4-tert-butyl-7a-(5-fluoro-2-pyridinyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid.
| Compound Name | (4aR,7aR)-2-benzamido-4-tert-butyl-7a-(5-fluoro-2-pyridinyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 118306246 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (4aR,7aR)-2-benzamido-4-tert-butyl-7a-(5-fluoro-2-pyridinyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid |
| SMILES | CC(C)(C)C1SC(NC(=O)c2ccccc2)=N[C@@]2(c3ccc(F)cn3)CN(C(=O)O)C[C@@H]12 |
| InChI | InChI=1S/C23H25FN4O3S/c1-22(2,3)18-16-12-28(21(30)31)13-23(16,17-10-9-15(24)11-25-17)27-20(32-18)26-19(29)14-7-5-4-6-8-14/h4-11,16,18H,12-13H2,1-3H3,(H,30,31)(H,26,27,29)/t16-,18?,23-/m0/s1 |
| InChIKey | VNNZYUUDTMUOOT-RAEDPMGTSA-N |
| XLogP | 3.97 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |