C16H18F2N2O2S — CID 135189062
N-[(4aS,5S,7aR)-5-(1,1-difluoroethyl)-7a-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 135189062) has the molecular formula C16H18F2N2O2S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[(4aS,5S,7aR)-5-(1,1-difluoroethyl)-7a-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aS,5S,7aR)-5-(1,1-difluoroethyl)-7a-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 135189062 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[(4aS,5S,7aR)-5-(1,1-difluoroethyl)-7a-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | CC(F)(F)[C@H]1OC[C@]2(C)N=C(NC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C16H18F2N2O2S/c1-15-9-22-12(16(2,17)18)11(15)8-23-14(20-15)19-13(21)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3,(H,19,20,21)/t11-,12+,15+/m1/s1 |
| InChIKey | XFOZEOKUOGYRTD-XUJVJEKNSA-N |
| XLogP | 2.95 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |