C22H25N3O3S2 — CID 86762224
tert-butyl (4aR,7aR)-2-benzamido-7a-thiophen-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate (PubChem CID 86762224) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl (4aR,7aR)-2-benzamido-7a-thiophen-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate.
| Compound Name | tert-butyl (4aR,7aR)-2-benzamido-7a-thiophen-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
|---|---|
| PubChem CID | 86762224 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | tert-butyl (4aR,7aR)-2-benzamido-7a-thiophen-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CSC(NC(=O)c3ccccc3)=N[C@@]2(c2cccs2)C1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-21(2,3)28-20(27)25-12-16-13-30-19(23-18(26)15-8-5-4-6-9-15)24-22(16,14-25)17-10-7-11-29-17/h4-11,16H,12-14H2,1-3H3,(H,23,24,26)/t16-,22-/m0/s1 |
| InChIKey | VFZQXFJJXBEEBJ-AOMKIAJQSA-N |
| XLogP | 4.34 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |