C19H19FN4O3S — CID 118306242
2-benzamido-7a-(5-fluoro-2-pyridinyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid (PubChem CID 118306242) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-benzamido-7a-(5-fluoro-2-pyridinyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid.
| Compound Name | 2-benzamido-7a-(5-fluoro-2-pyridinyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 118306242 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-benzamido-7a-(5-fluoro-2-pyridinyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylic acid |
| SMILES | O=C(NC1NC2(c3ccc(F)cn3)CN(C(=O)O)CC2CS1)c1ccccc1 |
| InChI | InChI=1S/C19H19FN4O3S/c20-14-6-7-15(21-8-14)19-11-24(18(26)27)9-13(19)10-28-17(23-19)22-16(25)12-4-2-1-3-5-12/h1-8,13,17,23H,9-11H2,(H,22,25)(H,26,27) |
| InChIKey | ZDYXPJFMKREYAV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |