C23H22BrF3N2O2S — CID 122484516
N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-[cyclopropyl(difluoro)methyl]-1,2,4,4a,5,7-hexahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 122484516) has the molecular formula C23H22BrF3N2O2S and a molecular weight of 527.41 g/mol. Its IUPAC name is N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-[cyclopropyl(difluoro)methyl]-1,2,4,4a,5,7-hexahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-[cyclopropyl(difluoro)methyl]-1,2,4,4a,5,7-hexahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 122484516 |
| Molecular Formula | C23H22BrF3N2O2S |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-[cyclopropyl(difluoro)methyl]-1,2,4,4a,5,7-hexahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | O=C(NC1N[C@@]2(c3cc(Br)ccc3F)CO[C@H](C(F)(F)C3CC3)[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C23H22BrF3N2O2S/c24-15-8-9-18(25)16(10-15)22-12-31-19(23(26,27)14-6-7-14)17(22)11-32-21(29-22)28-20(30)13-4-2-1-3-5-13/h1-5,8-10,14,17,19,21,29H,6-7,11-12H2,(H,28,30)/t17-,19+,21?,22-/m1/s1 |
| InChIKey | DYGHRTCIVNXCLV-IQKDYJHBSA-N |
| XLogP | 4.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |