C27H25BrFN3O3S — CID 90402012
benzyl 2-benzamido-7a-(5-bromo-2-fluorophenyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate (PubChem CID 90402012) has the molecular formula C27H25BrFN3O3S and a molecular weight of 570.48 g/mol. Its IUPAC name is benzyl 2-benzamido-7a-(5-bromo-2-fluorophenyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate.
| Compound Name | benzyl 2-benzamido-7a-(5-bromo-2-fluorophenyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
|---|---|
| PubChem CID | 90402012 |
| Molecular Formula | C27H25BrFN3O3S |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | benzyl 2-benzamido-7a-(5-bromo-2-fluorophenyl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
| SMILES | O=C(NC1NC2(c3cc(Br)ccc3F)CN(C(=O)OCc3ccccc3)CC2CS1)c1ccccc1 |
| InChI | InChI=1S/C27H25BrFN3O3S/c28-21-11-12-23(29)22(13-21)27-17-32(26(34)35-15-18-7-3-1-4-8-18)14-20(27)16-36-25(31-27)30-24(33)19-9-5-2-6-10-19/h1-13,20,25,31H,14-17H2,(H,30,33) |
| InChIKey | JLMMPPRTROZQEA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |