C15H16N2O4S — CID 178194682
benzyl (3aS,6aS)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxylate (PubChem CID 178194682) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is benzyl (3aS,6aS)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxylate.
| Compound Name | benzyl (3aS,6aS)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 178194682 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | benzyl (3aS,6aS)-3a-cyano-2,2-dioxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxylate |
| SMILES | N#C[C@@]12CN(C(=O)OCc3ccccc3)C[C@H]1CS(=O)(=O)C2 |
| InChI | InChI=1S/C15H16N2O4S/c16-9-15-10-17(6-13(15)8-22(19,20)11-15)14(18)21-7-12-4-2-1-3-5-12/h1-5,13H,6-8,10-11H2/t13-,15-/m0/s1 |
| InChIKey | MAEDJEKDFAYHRM-ZFWWWQNUSA-N |
| XLogP | 1.19 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |