C22H23N3O4 — CID 169084564
dibenzyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate (PubChem CID 169084564) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is dibenzyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate.
| Compound Name | dibenzyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 169084564 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | dibenzyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate |
| SMILES | N#CC[C@H]1CN(C(=O)OCc2ccccc2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23N3O4/c23-12-11-20-15-24(21(26)28-16-18-7-3-1-4-8-18)13-14-25(20)22(27)29-17-19-9-5-2-6-10-19/h1-10,20H,11,13-17H2/t20-/m0/s1 |
| InChIKey | YREUNYXELNJZOF-FQEVSTJZSA-N |
| XLogP | 3.56 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |