benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate

C15H19N3O3 — CID 118047052

IUPACbenzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate
SMILESCOCC1CN(C(=O)OCc2ccccc2)CCN1C#N
InChIInChI=1S/C15H19N3O3/c1-20-11-14-9-17(7-8-18(14)12-16)15(19)21-10-13-5-3-2-4-6-13/h2-6,14H,7-11H2,1H3
InChIKeyHXYIPKILXWHMAN-UHFFFAOYSA-N
MW289.33 g/mol
LogP1.44
Rot. Bonds4

About benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate

benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate (PubChem CID 118047052) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate
PubChem CID118047052
Molecular FormulaC15H19N3O3
Molecular Weight289.33 g/mol
Exact Mass289.14
IUPAC Namebenzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate
SMILESCOCC1CN(C(=O)OCc2ccccc2)CCN1C#N
InChIInChI=1S/C15H19N3O3/c1-20-11-14-9-17(7-8-18(14)12-16)15(19)21-10-13-5-3-2-4-6-13/h2-6,14H,7-11H2,1H3
InChIKeyHXYIPKILXWHMAN-UHFFFAOYSA-N
XLogP1.44
TPSA65.80 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.33
LogP ≤ 51.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}

Analyze benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate?
The IUPAC name of benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate (CID 118047052) is benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate.
What is the SMILES notation for benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate?
The canonical SMILES for benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate is COCC1CN(C(=O)OCc2ccccc2)CCN1C#N.
What is the InChIKey of benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate?
The InChIKey is HXYIPKILXWHMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-20-11-14-9-17(7-8-18(14)12-16)15(19)21-10-13-5-3-2-4-6-13/h2-6,14H,7-11H2,1H3.
What are the key properties of benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate?
benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate has a molecular weight of 289.33 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-cyano-3-(methoxymethyl)piperazine-1-carboxylate is sourced from PubChem (CID 118047052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).