C22H26N4O5 — CID 140869930
benzyl (3S)-4-(formamidocarbamoyl)-3-(phenylmethoxymethyl)piperazine-1-carboxylate (PubChem CID 140869930) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is benzyl (3S)-4-(formamidocarbamoyl)-3-(phenylmethoxymethyl)piperazine-1-carboxylate.
| Compound Name | benzyl (3S)-4-(formamidocarbamoyl)-3-(phenylmethoxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140869930 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | benzyl (3S)-4-(formamidocarbamoyl)-3-(phenylmethoxymethyl)piperazine-1-carboxylate |
| SMILES | O=CNNC(=O)N1CCN(C(=O)OCc2ccccc2)C[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C22H26N4O5/c27-17-23-24-21(28)26-12-11-25(22(29)31-15-19-9-5-2-6-10-19)13-20(26)16-30-14-18-7-3-1-4-8-18/h1-10,17,20H,11-16H2,(H,23,27)(H,24,28)/t20-/m0/s1 |
| InChIKey | RHVAKYFOIWSBON-FQEVSTJZSA-N |
| XLogP | 1.90 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|