C22H27N3O5 — CID 141471829
dibenzyl 2-(2-amino-2-hydroxyethyl)piperazine-1,4-dicarboxylate (PubChem CID 141471829) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is dibenzyl 2-(2-amino-2-hydroxyethyl)piperazine-1,4-dicarboxylate.
| Compound Name | dibenzyl 2-(2-amino-2-hydroxyethyl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 141471829 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | dibenzyl 2-(2-amino-2-hydroxyethyl)piperazine-1,4-dicarboxylate |
| SMILES | NC(O)CC1CN(C(=O)OCc2ccccc2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O5/c23-20(26)13-19-14-24(21(27)29-15-17-7-3-1-4-8-17)11-12-25(19)22(28)30-16-18-9-5-2-6-10-18/h1-10,19-20,26H,11-16,23H2 |
| InChIKey | QCRMVKFMLJELRO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|