C21H25N3O5 — CID 175047315
2-(2-amino-2-hydroxyethyl)-4-benzhydryloxycarbonylpiperazine-1-carboxylic acid (PubChem CID 175047315) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(2-amino-2-hydroxyethyl)-4-benzhydryloxycarbonylpiperazine-1-carboxylic acid.
| Compound Name | 2-(2-amino-2-hydroxyethyl)-4-benzhydryloxycarbonylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175047315 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-(2-amino-2-hydroxyethyl)-4-benzhydryloxycarbonylpiperazine-1-carboxylic acid |
| SMILES | NC(O)CC1CN(C(=O)OC(c2ccccc2)c2ccccc2)CCN1C(=O)O |
| InChI | InChI=1S/C21H25N3O5/c22-18(25)13-17-14-23(11-12-24(17)20(26)27)21(28)29-19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19,25H,11-14,22H2,(H,26,27) |
| InChIKey | IVSRAAQDULZUKB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|