C18H26N2O3 — CID 87323947
(2S)-4-(2,2-dimethyl-1-phenylpropyl)-2-(2-oxoethyl)piperazine-1-carboxylic acid (PubChem CID 87323947) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S)-4-(2,2-dimethyl-1-phenylpropyl)-2-(2-oxoethyl)piperazine-1-carboxylic acid.
| Compound Name | (2S)-4-(2,2-dimethyl-1-phenylpropyl)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87323947 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2S)-4-(2,2-dimethyl-1-phenylpropyl)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C(c1ccccc1)N1CCN(C(=O)O)[C@@H](CC=O)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-18(2,3)16(14-7-5-4-6-8-14)19-10-11-20(17(22)23)15(13-19)9-12-21/h4-8,12,15-16H,9-11,13H2,1-3H3,(H,22,23)/t15-,16?/m0/s1 |
| InChIKey | OXIUOXBRJKBGIU-VYRBHSGPSA-N |
| XLogP | 3.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|