C23H29NO4 — CID 10385289
ethyl 4-[(4-ethoxyphenyl)-phenylmethoxy]piperidine-1-carboxylate (PubChem CID 10385289) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 4-[(4-ethoxyphenyl)-phenylmethoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-ethoxyphenyl)-phenylmethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10385289 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | ethyl 4-[(4-ethoxyphenyl)-phenylmethoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(OC(c2ccccc2)c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C23H29NO4/c1-3-26-20-12-10-19(11-13-20)22(18-8-6-5-7-9-18)28-21-14-16-24(17-15-21)23(25)27-4-2/h5-13,21-22H,3-4,14-17H2,1-2H3 |
| InChIKey | JAAZPHKLRUZYJT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |