C26H30N2O3 — CID 161206861
ethyl 4-[(4-benzhydryloxypiperidin-1-yl)methyl]-2H-pyrrole-5-carboxylate (PubChem CID 161206861) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 4-[(4-benzhydryloxypiperidin-1-yl)methyl]-2H-pyrrole-5-carboxylate.
| Compound Name | ethyl 4-[(4-benzhydryloxypiperidin-1-yl)methyl]-2H-pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 161206861 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 4-[(4-benzhydryloxypiperidin-1-yl)methyl]-2H-pyrrole-5-carboxylate |
| SMILES | CCOC(=O)C1=NCC=C1CN1CCC(OC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N2O3/c1-2-30-26(29)24-22(13-16-27-24)19-28-17-14-23(15-18-28)31-25(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-13,23,25H,2,14-19H2,1H3 |
| InChIKey | UVSFWMYXNHCUHT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |