C25H26N2O3 — CID 89474624
ethyl 6-[(3-benzhydryloxyazetidin-1-yl)methyl]pyridine-2-carboxylate (PubChem CID 89474624) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is ethyl 6-[(3-benzhydryloxyazetidin-1-yl)methyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[(3-benzhydryloxyazetidin-1-yl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 89474624 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | ethyl 6-[(3-benzhydryloxyazetidin-1-yl)methyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(CN2CC(OC(c3ccccc3)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C25H26N2O3/c1-2-29-25(28)23-15-9-14-21(26-23)16-27-17-22(18-27)30-24(19-10-5-3-6-11-19)20-12-7-4-8-13-20/h3-15,22,24H,2,16-18H2,1H3 |
| InChIKey | YFVASEBXJIEBFR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |