C17H18N2O3 — CID 125445677
6-[[(3R)-3-phenoxypyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 125445677) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 6-[[(3R)-3-phenoxypyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[(3R)-3-phenoxypyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 125445677 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 6-[[(3R)-3-phenoxypyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2CC[C@@H](Oc3ccccc3)C2)n1 |
| InChI | InChI=1S/C17H18N2O3/c20-17(21)16-8-4-5-13(18-16)11-19-10-9-15(12-19)22-14-6-2-1-3-7-14/h1-8,15H,9-12H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | YDLLNIULXDQEMJ-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |