C19H21NO4 — CID 125441615
2-[4-[[(3S)-3-phenoxypyrrolidin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 125441615) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[4-[[(3S)-3-phenoxypyrrolidin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(3S)-3-phenoxypyrrolidin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 125441615 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-[4-[[(3S)-3-phenoxypyrrolidin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CN2CC[C@H](Oc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H21NO4/c21-19(22)14-23-16-8-6-15(7-9-16)12-20-11-10-18(13-20)24-17-4-2-1-3-5-17/h1-9,18H,10-14H2,(H,21,22)/t18-/m0/s1 |
| InChIKey | WHDZUJJKHMODMV-SFHVURJKSA-N |
| XLogP | 2.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |