C18H25NO4 — CID 74231456
2-[4-[[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]methyl]phenoxy]acetic acid (PubChem CID 74231456) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[4-[[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 74231456 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[4-[[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CN2CC[C@@]3(O)CCCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H25NO4/c20-17(21)13-23-16-6-4-14(5-7-16)11-19-10-9-18(22)8-2-1-3-15(18)12-19/h4-7,15,22H,1-3,8-13H2,(H,20,21)/t15-,18-/m0/s1 |
| InChIKey | AFKPNFOGPKXJGZ-YJBOKZPZSA-N |
| XLogP | 2.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |