C24H22F2N2O3 — CID 89474909
6-[[(3R)-3-[bis(4-fluorophenyl)methoxy]pyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 89474909) has the molecular formula C24H22F2N2O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is 6-[[(3R)-3-[bis(4-fluorophenyl)methoxy]pyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[(3R)-3-[bis(4-fluorophenyl)methoxy]pyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 89474909 |
| Molecular Formula | C24H22F2N2O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 6-[[(3R)-3-[bis(4-fluorophenyl)methoxy]pyrrolidin-1-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2CC[C@@H](OC(c3ccc(F)cc3)c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C24H22F2N2O3/c25-18-8-4-16(5-9-18)23(17-6-10-19(26)11-7-17)31-21-12-13-28(15-21)14-20-2-1-3-22(27-20)24(29)30/h1-11,21,23H,12-15H2,(H,29,30)/t21-/m1/s1 |
| InChIKey | ZRYFWKYCZGTSES-OAQYLSRUSA-N |
| XLogP | 4.44 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |