About benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate
benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate (PubChem CID 123460651) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate |
| PubChem CID | 123460651 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate |
| SMILES | NS1(=O)=CC2(CN(C(=O)OCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C13H16N2O3S/c14-19(17)9-13(10-19)7-15(8-13)12(16)18-6-11-4-2-1-3-5-11/h1-5,9H,6-8,10H2,(H2,14,17) |
| InChIKey | VOEBEFDHNXVGTO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate?
The IUPAC name of benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate (CID 123460651) is benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate.
What is the SMILES notation for benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate?
The canonical SMILES for benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate is NS1(=O)=CC2(CN(C(=O)OCc3ccccc3)C2)C1.
What is the InChIKey of benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate?
The InChIKey is VOEBEFDHNXVGTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3S/c14-19(17)9-13(10-19)7-15(8-13)12(16)18-6-11-4-2-1-3-5-11/h1-5,9H,6-8,10H2,(H2,14,17).
What are the key properties of benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate?
benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate has a molecular weight of 280.35 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-amino-2-oxo-2λ6-thia-6-azaspiro[3.3]hept-2-ene-6-carboxylate is sourced from PubChem (CID 123460651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).