C24H24N4O3S2 — CID 90265858
benzyl 2-benzamido-7a-(1,3-thiazol-5-yl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate (PubChem CID 90265858) has the molecular formula C24H24N4O3S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is benzyl 2-benzamido-7a-(1,3-thiazol-5-yl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate.
| Compound Name | benzyl 2-benzamido-7a-(1,3-thiazol-5-yl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
|---|---|
| PubChem CID | 90265858 |
| Molecular Formula | C24H24N4O3S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | benzyl 2-benzamido-7a-(1,3-thiazol-5-yl)-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
| SMILES | O=C(NC1NC2(c3cncs3)CN(C(=O)OCc3ccccc3)CC2CS1)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O3S2/c29-21(18-9-5-2-6-10-18)26-22-27-24(20-11-25-16-33-20)15-28(12-19(24)14-32-22)23(30)31-13-17-7-3-1-4-8-17/h1-11,16,19,22,27H,12-15H2,(H,26,29) |
| InChIKey | INKLQRHITIDERJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |