C17H22N2O2 — CID 154707787
benzyl (1S)-3,8-diazatricyclo[6.3.0.01,5]undecane-3-carboxylate (PubChem CID 154707787) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is benzyl (1S)-3,8-diazatricyclo[6.3.0.01,5]undecane-3-carboxylate.
| Compound Name | benzyl (1S)-3,8-diazatricyclo[6.3.0.01,5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 154707787 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | benzyl (1S)-3,8-diazatricyclo[6.3.0.01,5]undecane-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC2CCN3CCC[C@@]23C1 |
| InChI | InChI=1S/C17H22N2O2/c20-16(21-12-14-5-2-1-3-6-14)18-11-15-7-10-19-9-4-8-17(15,19)13-18/h1-3,5-6,15H,4,7-13H2/t15?,17-/m1/s1 |
| InChIKey | ALQYDQPHCPWFEC-OMOCHNIRSA-N |
| XLogP | 2.49 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |