C17H16BrNO — CID 10065196
N-[(2R)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 10065196) has the molecular formula C17H16BrNO and a molecular weight of 330.22 g/mol. Its IUPAC name is N-[(2R)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | N-[(2R)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 10065196 |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[(2R)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCc2cc(Br)ccc2C1)c1ccccc1 |
| InChI | InChI=1S/C17H16BrNO/c18-15-8-6-14-11-16(9-7-13(14)10-15)19-17(20)12-4-2-1-3-5-12/h1-6,8,10,16H,7,9,11H2,(H,19,20)/t16-/m1/s1 |
| InChIKey | GFENDOZFUJGLNJ-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |