C15H17FN6S — CID 118306347
6-(5-fluoropyrimidin-2-yl)-7a-pyridin-2-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-amine (PubChem CID 118306347) has the molecular formula C15H17FN6S and a molecular weight of 332.41 g/mol. Its IUPAC name is 6-(5-fluoropyrimidin-2-yl)-7a-pyridin-2-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-amine.
| Compound Name | 6-(5-fluoropyrimidin-2-yl)-7a-pyridin-2-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 118306347 |
| Molecular Formula | C15H17FN6S |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 6-(5-fluoropyrimidin-2-yl)-7a-pyridin-2-yl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1NC2(c3ccccn3)CN(c3ncc(F)cn3)CC2CS1 |
| InChI | InChI=1S/C15H17FN6S/c16-11-5-19-14(20-6-11)22-7-10-8-23-13(17)21-15(10,9-22)12-3-1-2-4-18-12/h1-6,10,13,21H,7-9,17H2 |
| InChIKey | NJVBHBOOJSQDLI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |