C17H19FN4O — CID 124782656
(3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-3a-(pyridin-2-yloxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 124782656) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is (3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-3a-(pyridin-2-yloxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-3a-(pyridin-2-yloxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 124782656 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-3a-(pyridin-2-yloxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | Fc1cnc(N2C[C@@H]3CCC[C@]3(COc3ccccn3)C2)nc1 |
| InChI | InChI=1S/C17H19FN4O/c18-14-8-20-16(21-9-14)22-10-13-4-3-6-17(13,11-22)12-23-15-5-1-2-7-19-15/h1-2,5,7-9,13H,3-4,6,10-12H2/t13-,17+/m0/s1 |
| InChIKey | ITGUNACMLANPQO-SUMWQHHRSA-N |
| XLogP | 2.70 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |