C19H23FN4O2 — CID 124519779
(4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 124519779) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is (4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | (4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 124519779 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4aR,8aS)-6-(5-fluoropyrimidin-2-yl)-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | Fc1cnc(N2CC[C@@H]3OCCC[C@]3(COCc3ccccn3)C2)nc1 |
| InChI | InChI=1S/C19H23FN4O2/c20-15-10-22-18(23-11-15)24-8-5-17-19(13-24,6-3-9-26-17)14-25-12-16-4-1-2-7-21-16/h1-2,4,7,10-11,17H,3,5-6,8-9,12-14H2/t17-,19+/m0/s1 |
| InChIKey | WIRHWUXGJXMIRU-PKOBYXMFSA-N |
| XLogP | 2.60 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |