C16H24N2O4S — CID 98810773
(4aS,8aR)-6-methylsulfonyl-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 98810773) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is (4aS,8aR)-6-methylsulfonyl-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aR)-6-methylsulfonyl-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 98810773 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (4aS,8aR)-6-methylsulfonyl-4a-(pyridin-2-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | CS(=O)(=O)N1CC[C@H]2OCCC[C@@]2(COCc2ccccn2)C1 |
| InChI | InChI=1S/C16H24N2O4S/c1-23(19,20)18-9-6-15-16(12-18,7-4-10-22-15)13-21-11-14-5-2-3-8-17-14/h2-3,5,8,15H,4,6-7,9-13H2,1H3/t15-,16+/m1/s1 |
| InChIKey | XZJVEDMSJMAFCA-CVEARBPZSA-N |
| XLogP | 1.43 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |