C17H17N3OS2 — CID 86762223
N-[(4aR,7aR)-7a-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 86762223) has the molecular formula C17H17N3OS2 and a molecular weight of 343.48 g/mol. Its IUPAC name is N-[(4aR,7aR)-7a-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aR)-7a-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 86762223 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[(4aR,7aR)-7a-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-pyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | O=C(NC1=N[C@@]2(c3cccs3)CNC[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3OS2/c21-15(12-5-2-1-3-6-12)19-16-20-17(14-7-4-8-22-14)11-18-9-13(17)10-23-16/h1-8,13,18H,9-11H2,(H,19,20,21)/t13-,17-/m0/s1 |
| InChIKey | ZSSIDWZKCIJDBD-GUYCJALGSA-N |
| XLogP | 2.70 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |