C25H25F4N5O2S — CID 126557211
(4S,5S,6S)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,5,6-trimethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 126557211) has the molecular formula C25H25F4N5O2S and a molecular weight of 535.57 g/mol. Its IUPAC name is (4S,5S,6S)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,5,6-trimethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,5S,6S)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,5,6-trimethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 126557211 |
| Molecular Formula | C25H25F4N5O2S |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | (4S,5S,6S)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,5,6-trimethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | C#CCOc1cnc(/C(F)=C/c2ccc(F)c([C@@]3(C)N=C(N)S[C@](C)(C(=O)NCC(F)F)[C@H]3C)c2)cn1 |
| InChI | InChI=1S/C25H25F4N5O2S/c1-5-8-36-21-13-31-19(11-32-21)18(27)10-15-6-7-17(26)16(9-15)24(3)14(2)25(4,37-23(30)34-24)22(35)33-12-20(28)29/h1,6-7,9-11,13-14,20H,8,12H2,2-4H3,(H2,30,34)(H,33,35)/b18-10-/t14-,24-,25-/m0/s1 |
| InChIKey | DEDKLRPLNYWRBR-OSKIJCRGSA-N |
| XLogP | 4.15 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|