C23H24F2N6OS — CID 126558822
(4S,5S,6S)-2-amino-4-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 126558822) has the molecular formula C23H24F2N6OS and a molecular weight of 470.55 g/mol. Its IUPAC name is (4S,5S,6S)-2-amino-4-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,5S,6S)-2-amino-4-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 126558822 |
| Molecular Formula | C23H24F2N6OS |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (4S,5S,6S)-2-amino-4-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | C[C@@H]1[C@@](C)(C(=O)N(C)C)SC(N)=N[C@]1(C)c1cc(/C=C(\F)c2cnc(C#N)cn2)ccc1F |
| InChI | InChI=1S/C23H24F2N6OS/c1-13-22(2,30-21(27)33-23(13,3)20(32)31(4)5)16-8-14(6-7-17(16)24)9-18(25)19-12-28-15(10-26)11-29-19/h6-9,11-13H,1-5H3,(H2,27,30)/b18-9-/t13-,22-,23-/m0/s1 |
| InChIKey | XNMYMVUGYRCLCB-ZUHRAOMKSA-N |
| XLogP | 3.71 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |