C16H22F2N4OS — CID 126487995
(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 126487995) has the molecular formula C16H22F2N4OS and a molecular weight of 356.44 g/mol. Its IUPAC name is (4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 126487995 |
| Molecular Formula | C16H22F2N4OS |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-N,N,4,5,6-pentamethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | C[C@@H]1[C@@](C)(C(=O)N(C)C)SC(N)=N[C@]1(C)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C16H22F2N4OS/c1-8-15(2,10-6-9(19)7-11(17)12(10)18)21-14(20)24-16(8,3)13(23)22(4)5/h6-8H,19H2,1-5H3,(H2,20,21)/t8-,15-,16-/m0/s1 |
| InChIKey | CDRALQCZLAWNOX-FOJFLGBKSA-N |
| XLogP | 2.31 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|