C14H17F2N3O4S2 — CID 130435249
(4S,6R)-4-(2,3-difluoro-5-nitrophenyl)-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine (PubChem CID 130435249) has the molecular formula C14H17F2N3O4S2 and a molecular weight of 393.44 g/mol. Its IUPAC name is (4S,6R)-4-(2,3-difluoro-5-nitrophenyl)-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,6R)-4-(2,3-difluoro-5-nitrophenyl)-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 130435249 |
| Molecular Formula | C14H17F2N3O4S2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (4S,6R)-4-(2,3-difluoro-5-nitrophenyl)-4,5,6-trimethyl-6-methylsulfonyl-5H-1,3-thiazin-2-amine |
| SMILES | CC1[C@@](C)(S(C)(=O)=O)SC(N)=N[C@]1(C)c1cc([N+](=O)[O-])cc(F)c1F |
| InChI | InChI=1S/C14H17F2N3O4S2/c1-7-13(2,18-12(17)24-14(7,3)25(4,22)23)9-5-8(19(20)21)6-10(15)11(9)16/h5-7H,1-4H3,(H2,17,18)/t7?,13-,14+/m0/s1 |
| InChIKey | QMSCMYJFJMUWJZ-CPPBKLTOSA-N |
| XLogP | 2.55 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|