C15H21F2N3OS — CID 118884740
(1S)-1-[(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]ethanol (PubChem CID 118884740) has the molecular formula C15H21F2N3OS and a molecular weight of 329.42 g/mol. Its IUPAC name is (1S)-1-[(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]ethanol.
| Compound Name | (1S)-1-[(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]ethanol |
|---|---|
| PubChem CID | 118884740 |
| Molecular Formula | C15H21F2N3OS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (1S)-1-[(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]ethanol |
| SMILES | C[C@H](O)[C@@]1(C)SC(N)=N[C@](C)(c2cc(N)cc(F)c2F)[C@@H]1C |
| InChI | InChI=1S/C15H21F2N3OS/c1-7-14(3,10-5-9(18)6-11(16)12(10)17)20-13(19)22-15(7,4)8(2)21/h5-8,21H,18H2,1-4H3,(H2,19,20)/t7-,8-,14-,15-/m0/s1 |
| InChIKey | LTZFBGUORJPNJN-XKEOVWDISA-N |
| XLogP | 2.60 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|